diff --git a/src/simplewallet/simplewallet.cpp b/src/simplewallet/simplewallet.cpp
index b9e30f9d9..40be0230c 100644
--- a/src/simplewallet/simplewallet.cpp
+++ b/src/simplewallet/simplewallet.cpp
@@ -6780,7 +6780,7 @@ bool simple_wallet::transfer_main(const std::vector<std::string> &args_, bool ca
   {
     // figure out what tx will be necessary
     auto ptx_vector = m_wallet->create_transactions_2(dsts, fake_outs_count, priority, extra,
-      m_current_subaddress_account, subaddr_indices, subtract_fee_from_outputs);
+      m_current_subaddress_account, subaddr_indices, {}, subtract_fee_from_outputs);
 
     if (ptx_vector.empty())
     {
diff --git a/src/wallet/api/CMakeLists.txt b/src/wallet/api/CMakeLists.txt
index af7948d8a..bb740e2ac 100644
--- a/src/wallet/api/CMakeLists.txt
+++ b/src/wallet/api/CMakeLists.txt
@@ -40,7 +40,9 @@ set(wallet_api_sources
   address_book.cpp
   subaddress.cpp
   subaddress_account.cpp
-  unsigned_transaction.cpp)
+  unsigned_transaction.cpp
+  coins.cpp
+  coins_info.cpp)
 
 set(wallet_api_headers
     wallet2_api.h)
@@ -55,7 +57,9 @@ set(wallet_api_private_headers
   address_book.h
   subaddress.h
   subaddress_account.h
-  unsigned_transaction.h)
+  unsigned_transaction.h
+  coins.h
+  coins_info.h)
 
 monero_private_headers(wallet_api
   ${wallet_api_private_headers})
diff --git a/src/wallet/api/coins.cpp b/src/wallet/api/coins.cpp
new file mode 100644
index 000000000..2321c638d
--- /dev/null
+++ b/src/wallet/api/coins.cpp
@@ -0,0 +1,185 @@
+#include "coins.h"
+#include "coins_info.h"
+#include "wallet.h"
+#include "crypto/hash.h"
+#include "wallet/wallet2.h"
+#include "common_defines.h"
+
+#include <string>
+#include <vector>
+
+using namespace epee;
+
+namespace Monero {
+
+Coins::~Coins() = default;
+
+CoinsImpl::CoinsImpl(WalletImpl *wallet)
+        : m_wallet(wallet) {}
+
+CoinsImpl::~CoinsImpl()
+{
+    for (auto t : m_rows)
+        delete t;
+}
+
+int CoinsImpl::count() const
+{
+    boost::shared_lock<boost::shared_mutex> lock(m_rowsMutex);
+    int result = m_rows.size();
+    return result;
+}
+
+CoinsInfo *CoinsImpl::coin(int index) const
+{
+    boost::shared_lock<boost::shared_mutex> lock(m_rowsMutex);
+    // sanity check
+    if (index < 0)
+        return nullptr;
+    auto index_ = static_cast<unsigned>(index);
+    return index_ < m_rows.size() ? m_rows[index_] : nullptr;
+}
+
+std::vector<CoinsInfo *> CoinsImpl::getAll() const
+{
+    boost::shared_lock<boost::shared_mutex> lock(m_rowsMutex);
+    return m_rows;
+}
+
+
+void CoinsImpl::refresh()
+{
+    LOG_PRINT_L2("Refreshing coins");
+
+    boost::unique_lock<boost::shared_mutex> lock(m_rowsMutex);
+    boost::shared_lock<boost::shared_mutex> transfers_lock(m_wallet->m_wallet->m_transfers_mutex);
+
+    // delete old outputs;
+    for (auto t : m_rows)
+        delete t;
+    m_rows.clear();
+
+    for (size_t i = 0; i < m_wallet->m_wallet->get_num_transfer_details(); ++i)
+    {
+        const tools::wallet2::transfer_details &td = m_wallet->m_wallet->get_transfer_details(i);
+
+        auto ci = new CoinsInfoImpl();
+        ci->m_blockHeight = td.m_block_height;
+        ci->m_hash = string_tools::pod_to_hex(td.m_txid);
+        ci->m_internalOutputIndex = td.m_internal_output_index;
+        ci->m_globalOutputIndex = td.m_global_output_index;
+        ci->m_spent = td.m_spent;
+        ci->m_frozen = td.m_frozen;
+        ci->m_spentHeight = td.m_spent_height;
+        ci->m_amount = td.m_amount;
+        ci->m_rct = td.m_rct;
+        ci->m_keyImageKnown = td.m_key_image_known;
+        ci->m_pkIndex = td.m_pk_index;
+        ci->m_subaddrIndex = td.m_subaddr_index.minor;
+        ci->m_subaddrAccount = td.m_subaddr_index.major;
+        ci->m_address = m_wallet->m_wallet->get_subaddress_as_str(td.m_subaddr_index); // todo: this is expensive, cache maybe?
+        ci->m_addressLabel = m_wallet->m_wallet->get_subaddress_label(td.m_subaddr_index);
+        ci->m_keyImage = string_tools::pod_to_hex(td.m_key_image);
+        ci->m_unlockTime = td.m_tx.unlock_time;
+        ci->m_unlocked = m_wallet->m_wallet->is_transfer_unlocked(td);
+        ci->m_pubKey = string_tools::pod_to_hex(td.get_public_key());
+        ci->m_coinbase = td.m_tx.vin.size() == 1 && td.m_tx.vin[0].type() == typeid(cryptonote::txin_gen);
+        ci->m_description = m_wallet->m_wallet->get_tx_note(td.m_txid);
+
+        m_rows.push_back(ci);
+    }
+}
+
+void CoinsImpl::setFrozen(std::string public_key)
+{
+    crypto::public_key pk;
+    if (!epee::string_tools::hex_to_pod(public_key, pk))
+    {
+        LOG_ERROR("Invalid public key: " << public_key);
+        return;
+    }
+
+    try
+    {
+        m_wallet->m_wallet->freeze(pk);
+        refresh();
+    }
+    catch (const std::exception& e)
+    {
+        LOG_ERROR("setFrozen: " << e.what());
+    }
+}
+
+void CoinsImpl::setFrozen(int index)
+{
+    try
+    {
+        m_wallet->m_wallet->freeze(index);
+        refresh();
+    }
+    catch (const std::exception& e)
+    {
+        LOG_ERROR("setLabel: " << e.what());
+    }
+}
+
+void CoinsImpl::thaw(std::string public_key)
+{
+    crypto::public_key pk;
+    if (!epee::string_tools::hex_to_pod(public_key, pk))
+    {
+        LOG_ERROR("Invalid public key: " << public_key);
+        return;
+    }
+
+    try
+    {
+        m_wallet->m_wallet->thaw(pk);
+        refresh();
+    }
+    catch (const std::exception& e)
+    {
+        LOG_ERROR("thaw: " << e.what());
+    }
+}
+
+void CoinsImpl::thaw(int index)
+{
+    try
+    {
+        m_wallet->m_wallet->thaw(index);
+        refresh();
+    }
+    catch (const std::exception& e)
+    {
+        LOG_ERROR("thaw: " << e.what());
+    }
+}
+
+bool CoinsImpl::isTransferUnlocked(uint64_t unlockTime, uint64_t blockHeight) {
+    return m_wallet->m_wallet->is_transfer_unlocked(unlockTime, blockHeight);
+}
+
+void CoinsImpl::setDescription(const std::string &public_key, const std::string &description)
+{
+    crypto::public_key pk;
+    if (!epee::string_tools::hex_to_pod(public_key, pk))
+    {
+        LOG_ERROR("Invalid public key: " << public_key);
+        return;
+    }
+
+    try
+    {
+        const size_t index = m_wallet->m_wallet->get_transfer_details(pk);
+        const tools::wallet2::transfer_details &td = m_wallet->m_wallet->get_transfer_details(index);
+        m_wallet->m_wallet->set_tx_note(td.m_txid, description);
+        refresh();
+    }
+    catch (const std::exception& e)
+    {
+        LOG_ERROR("setDescription: " << e.what());
+    }
+}
+
+} // namespace
diff --git a/src/wallet/api/coins.h b/src/wallet/api/coins.h
new file mode 100644
index 000000000..b7a0a8642
--- /dev/null
+++ b/src/wallet/api/coins.h
@@ -0,0 +1,40 @@
+#ifndef FEATHER_COINS_H
+#define FEATHER_COINS_H
+
+#include "wallet/api/wallet2_api.h"
+#include "wallet/wallet2.h"
+
+namespace Monero {
+
+class WalletImpl;
+
+class CoinsImpl : public Coins
+{
+public:
+    explicit CoinsImpl(WalletImpl * wallet);
+    ~CoinsImpl() override;
+    int count() const override;
+    CoinsInfo * coin(int index) const override;
+    std::vector<CoinsInfo*> getAll() const override;
+    void refresh() override;
+
+    void setFrozen(std::string public_key) override;
+    void setFrozen(int index) override;
+    void thaw(std::string public_key) override;
+    void thaw(int index) override;
+
+    bool isTransferUnlocked(uint64_t unlockTime, uint64_t blockHeight) override;
+
+    void setDescription(const std::string &public_key, const std::string &description) override;
+
+private:
+    WalletImpl *m_wallet;
+    std::vector<CoinsInfo*> m_rows;
+    mutable boost::shared_mutex   m_rowsMutex;
+};
+
+}
+
+namespace Bitmonero = Monero;
+
+#endif //FEATHER_COINS_H
diff --git a/src/wallet/api/coins_info.cpp b/src/wallet/api/coins_info.cpp
new file mode 100644
index 000000000..5f2c4e1e4
--- /dev/null
+++ b/src/wallet/api/coins_info.cpp
@@ -0,0 +1,122 @@
+#include "coins_info.h"
+
+using namespace std;
+
+namespace Monero {
+
+CoinsInfo::~CoinsInfo() = default;
+
+CoinsInfoImpl::CoinsInfoImpl()
+        : m_blockHeight(0)
+        , m_internalOutputIndex(0)
+        , m_globalOutputIndex(0)
+        , m_spent(false)
+        , m_frozen(false)
+        , m_spentHeight(0)
+        , m_amount(0)
+        , m_rct(false)
+        , m_keyImageKnown(false)
+        , m_pkIndex(0)
+        , m_subaddrAccount(0)
+        , m_subaddrIndex(0)
+        , m_unlockTime(0)
+        , m_unlocked(false)
+{
+
+}
+
+CoinsInfoImpl::~CoinsInfoImpl() = default;
+
+uint64_t CoinsInfoImpl::blockHeight() const
+{
+    return m_blockHeight;
+}
+
+string CoinsInfoImpl::hash() const
+{
+    return m_hash;
+}
+
+size_t CoinsInfoImpl::internalOutputIndex() const {
+    return m_internalOutputIndex;
+}
+
+uint64_t CoinsInfoImpl::globalOutputIndex() const
+{
+    return m_globalOutputIndex;
+}
+
+bool CoinsInfoImpl::spent() const
+{
+    return m_spent;
+}
+
+bool CoinsInfoImpl::frozen() const
+{
+    return m_frozen;
+}
+
+uint64_t CoinsInfoImpl::spentHeight() const
+{
+    return m_spentHeight;
+}
+
+uint64_t CoinsInfoImpl::amount() const
+{
+    return m_amount;
+}
+
+bool CoinsInfoImpl::rct() const {
+    return m_rct;
+}
+
+bool CoinsInfoImpl::keyImageKnown() const {
+    return m_keyImageKnown;
+}
+
+size_t CoinsInfoImpl::pkIndex() const {
+    return m_pkIndex;
+}
+
+uint32_t CoinsInfoImpl::subaddrIndex() const {
+    return m_subaddrIndex;
+}
+
+uint32_t CoinsInfoImpl::subaddrAccount() const {
+    return m_subaddrAccount;
+}
+
+string CoinsInfoImpl::address() const {
+    return m_address;
+}
+
+string CoinsInfoImpl::addressLabel() const {
+    return m_addressLabel;
+}
+
+string CoinsInfoImpl::keyImage() const {
+    return m_keyImage;
+}
+
+uint64_t CoinsInfoImpl::unlockTime() const {
+    return m_unlockTime;
+}
+
+bool CoinsInfoImpl::unlocked() const {
+    return m_unlocked;
+}
+
+string CoinsInfoImpl::pubKey() const {
+    return m_pubKey;
+}
+
+bool CoinsInfoImpl::coinbase() const {
+    return m_coinbase;
+}
+
+string CoinsInfoImpl::description() const {
+    return m_description;
+}
+} // namespace
+
+namespace Bitmonero = Monero;
diff --git a/src/wallet/api/coins_info.h b/src/wallet/api/coins_info.h
new file mode 100644
index 000000000..c43e45abd
--- /dev/null
+++ b/src/wallet/api/coins_info.h
@@ -0,0 +1,71 @@
+#ifndef FEATHER_COINS_INFO_H
+#define FEATHER_COINS_INFO_H
+
+#include "wallet/api/wallet2_api.h"
+#include <string>
+#include <ctime>
+
+namespace Monero {
+
+class CoinsImpl;
+
+class CoinsInfoImpl : public CoinsInfo
+{
+public:
+    CoinsInfoImpl();
+    ~CoinsInfoImpl();
+
+    virtual uint64_t blockHeight() const override;
+    virtual std::string hash() const override;
+    virtual size_t internalOutputIndex() const override;
+    virtual uint64_t globalOutputIndex() const override;
+    virtual bool spent() const override;
+    virtual bool frozen() const override;
+    virtual uint64_t spentHeight() const override;
+    virtual uint64_t amount() const override;
+    virtual bool rct() const override;
+    virtual bool keyImageKnown() const override;
+    virtual size_t pkIndex() const override;
+    virtual uint32_t subaddrIndex() const override;
+    virtual uint32_t subaddrAccount() const override;
+    virtual std::string address() const override;
+    virtual std::string addressLabel() const override;
+    virtual std::string keyImage() const override;
+    virtual uint64_t unlockTime() const override;
+    virtual bool unlocked() const override;
+    virtual std::string pubKey() const override;
+    virtual bool coinbase() const override;
+    virtual std::string description() const override;
+
+private:
+    uint64_t    m_blockHeight;
+    std::string m_hash;
+    size_t      m_internalOutputIndex;
+    uint64_t    m_globalOutputIndex;
+    bool        m_spent;
+    bool        m_frozen;
+    uint64_t    m_spentHeight;
+    uint64_t    m_amount;
+    bool        m_rct;
+    bool        m_keyImageKnown;
+    size_t      m_pkIndex;
+    uint32_t    m_subaddrIndex;
+    uint32_t    m_subaddrAccount;
+    std::string m_address;
+    std::string m_addressLabel;
+    std::string m_keyImage;
+    uint64_t    m_unlockTime;
+    bool        m_unlocked;
+    std::string m_pubKey;
+    bool        m_coinbase;
+    std::string m_description;
+
+    friend class CoinsImpl;
+
+};
+
+} // namespace
+
+namespace Bitmonero = Monero;
+
+#endif //FEATHER_COINS_INFO_H
diff --git a/src/wallet/api/wallet.cpp b/src/wallet/api/wallet.cpp
index 085cf49c0..7f0f2e028 100644
--- a/src/wallet/api/wallet.cpp
+++ b/src/wallet/api/wallet.cpp
@@ -35,6 +35,7 @@
 #include "transaction_history.h"
 #include "address_book.h"
 #include "subaddress.h"
+#include "coins.h"
 #include "subaddress_account.h"
 #include "common_defines.h"
 #include "common/util.h"
@@ -435,6 +436,7 @@ WalletImpl::WalletImpl(NetworkType nettype, uint64_t kdf_rounds)
     m_refreshEnabled = false;
     m_addressBook.reset(new AddressBookImpl(this));
     m_subaddress.reset(new SubaddressImpl(this));
+    m_coins.reset(new CoinsImpl(this));
     m_subaddressAccount.reset(new SubaddressAccountImpl(this));
 
 
@@ -1581,7 +1583,7 @@ PendingTransaction* WalletImpl::restoreMultisigTransaction(const string& signDat
 //    - unconfirmed_transfer_details;
 //    - confirmed_transfer_details)
 
-PendingTransaction *WalletImpl::createTransactionMultDest(const std::vector<string> &dst_addr, const string &payment_id, optional<std::vector<uint64_t>> amount, uint32_t mixin_count, PendingTransaction::Priority priority, uint32_t subaddr_account, std::set<uint32_t> subaddr_indices)
+PendingTransaction *WalletImpl::createTransactionMultDest(const std::vector<string> &dst_addr, const string &payment_id, optional<std::vector<uint64_t>> amount, uint32_t mixin_count, PendingTransaction::Priority priority, uint32_t subaddr_account, std::set<uint32_t> subaddr_indices, const std::set<std::string> &preferred_inputs)
 
 {
     clearStatus();
@@ -1647,6 +1649,19 @@ PendingTransaction *WalletImpl::createTransactionMultDest(const std::vector<stri
                 }
             }
         }
+        std::vector<crypto::key_image> preferred_input_list;
+        if (!preferred_inputs.empty()) {
+          for (const auto &public_key : preferred_inputs) {
+            crypto::key_image keyImage;
+            bool r = epee::string_tools::hex_to_pod(public_key, keyImage);
+            if (!r) {
+              error = true;
+              setStatusError(tr("failed to parse key image"));
+              break;
+            }
+            preferred_input_list.push_back(keyImage);
+          }
+        }
         if (error) {
             break;
         }
@@ -1661,11 +1676,11 @@ PendingTransaction *WalletImpl::createTransactionMultDest(const std::vector<stri
             if (amount) {
                 transaction->m_pending_tx = m_wallet->create_transactions_2(dsts, fake_outs_count,
                                                                             adjusted_priority,
-                                                                            extra, subaddr_account, subaddr_indices);
+                                                                            extra, subaddr_account, subaddr_indices, preferred_input_list);
             } else {
                 transaction->m_pending_tx = m_wallet->create_transactions_all(0, info.address, info.is_subaddress, 1, fake_outs_count,
                                                                               adjusted_priority,
-                                                                              extra, subaddr_account, subaddr_indices);
+                                                                              extra, subaddr_account, subaddr_indices, preferred_input_list);
             }
             pendingTxPostProcess(transaction);
 
@@ -1746,10 +1761,10 @@ PendingTransaction *WalletImpl::createTransactionMultDest(const std::vector<stri
 }
 
 PendingTransaction *WalletImpl::createTransaction(const string &dst_addr, const string &payment_id, optional<uint64_t> amount, uint32_t mixin_count,
-                                                  PendingTransaction::Priority priority, uint32_t subaddr_account, std::set<uint32_t> subaddr_indices)
+                                                  PendingTransaction::Priority priority, uint32_t subaddr_account, std::set<uint32_t> subaddr_indices, const std::set<std::string> &preferred_inputs)
 
 {
-    return createTransactionMultDest(std::vector<string> {dst_addr}, payment_id, amount ? (std::vector<uint64_t> {*amount}) : (optional<std::vector<uint64_t>>()), mixin_count, priority, subaddr_account, subaddr_indices);
+    return createTransactionMultDest(std::vector<string> {dst_addr}, payment_id, amount ? (std::vector<uint64_t> {*amount}) : (optional<std::vector<uint64_t>>()), mixin_count, priority, subaddr_account, subaddr_indices, preferred_inputs);
 }
 
 PendingTransaction *WalletImpl::createSweepUnmixableTransaction()
@@ -1871,6 +1886,11 @@ AddressBook *WalletImpl::addressBook()
     return m_addressBook.get();
 }
 
+Coins *WalletImpl::coins()
+{
+    return m_coins.get();
+}
+
 Subaddress *WalletImpl::subaddress()
 {
     return m_subaddress.get();
diff --git a/src/wallet/api/wallet.h b/src/wallet/api/wallet.h
index 787215ab3..3a426e889 100644
--- a/src/wallet/api/wallet.h
+++ b/src/wallet/api/wallet.h
@@ -46,6 +46,7 @@ class PendingTransactionImpl;
 class UnsignedTransactionImpl;
 class AddressBookImpl;
 class SubaddressImpl;
+class CoinsImpl;
 class SubaddressAccountImpl;
 struct Wallet2CallbackImpl;
 
@@ -166,12 +167,14 @@ public:
                                         optional<std::vector<uint64_t>> amount, uint32_t mixin_count,
                                         PendingTransaction::Priority priority = PendingTransaction::Priority_Low,
                                         uint32_t subaddr_account = 0,
-                                        std::set<uint32_t> subaddr_indices = {}) override;
+                                        std::set<uint32_t> subaddr_indices = {},
+                                        const std::set<std::string> &preferred_inputs = {}) override;
     PendingTransaction * createTransaction(const std::string &dst_addr, const std::string &payment_id,
                                         optional<uint64_t> amount, uint32_t mixin_count,
                                         PendingTransaction::Priority priority = PendingTransaction::Priority_Low,
                                         uint32_t subaddr_account = 0,
-                                        std::set<uint32_t> subaddr_indices = {}) override;
+                                        std::set<uint32_t> subaddr_indices = {},
+                                        const std::set<std::string> &preferred_inputs = {}) override;
     virtual PendingTransaction * createSweepUnmixableTransaction() override;
     bool submitTransaction(const std::string &fileName) override;
     virtual UnsignedTransaction * loadUnsignedTx(const std::string &unsigned_filename) override;
@@ -186,6 +189,7 @@ public:
                                             PendingTransaction::Priority priority) const override;
     virtual TransactionHistory * history() override;
     virtual AddressBook * addressBook() override;
+    virtual Coins * coins() override;
     virtual Subaddress * subaddress() override;
     virtual SubaddressAccount * subaddressAccount() override;
     virtual void setListener(WalletListener * l) override;
@@ -256,6 +260,7 @@ private:
     friend class TransactionHistoryImpl;
     friend struct Wallet2CallbackImpl;
     friend class AddressBookImpl;
+    friend class CoinsImpl;
     friend class SubaddressImpl;
     friend class SubaddressAccountImpl;
 
@@ -268,6 +273,7 @@ private:
     std::unique_ptr<Wallet2CallbackImpl> m_wallet2Callback;
     std::unique_ptr<AddressBookImpl>  m_addressBook;
     std::unique_ptr<SubaddressImpl>  m_subaddress;
+    std::unique_ptr<CoinsImpl> m_coins;
     std::unique_ptr<SubaddressAccountImpl>  m_subaddressAccount;
 
     // multi-threaded refresh stuff
diff --git a/src/wallet/api/wallet2_api.h b/src/wallet/api/wallet2_api.h
index 9ea753083..942b17d74 100644
--- a/src/wallet/api/wallet2_api.h
+++ b/src/wallet/api/wallet2_api.h
@@ -261,6 +261,51 @@ struct AddressBook
     virtual int lookupPaymentID(const std::string &payment_id) const = 0;
 };
 
+/**
+ * @brief The CoinsInfo - interface for displaying coins information
+ */
+struct CoinsInfo
+{
+    virtual ~CoinsInfo() = 0;
+
+    virtual uint64_t blockHeight() const = 0;
+    virtual std::string hash() const = 0;
+    virtual size_t internalOutputIndex() const = 0;
+    virtual uint64_t globalOutputIndex() const = 0;
+    virtual bool spent() const = 0;
+    virtual bool frozen() const = 0;
+    virtual uint64_t spentHeight() const = 0;
+    virtual uint64_t amount() const = 0;
+    virtual bool rct() const = 0;
+    virtual bool keyImageKnown() const = 0;
+    virtual size_t pkIndex() const = 0;
+    virtual uint32_t subaddrIndex() const = 0;
+    virtual uint32_t subaddrAccount() const = 0;
+    virtual std::string address() const = 0;
+    virtual std::string addressLabel() const = 0;
+    virtual std::string keyImage() const = 0;
+    virtual uint64_t unlockTime() const = 0;
+    virtual bool unlocked() const = 0;
+    virtual std::string pubKey() const = 0;
+    virtual bool coinbase() const = 0;
+    virtual std::string description() const = 0;
+};
+
+struct Coins
+{
+    virtual ~Coins() = 0;
+    virtual int count() const = 0;
+    virtual CoinsInfo * coin(int index)  const = 0;
+    virtual std::vector<CoinsInfo*> getAll() const = 0;
+    virtual void refresh() = 0;
+    virtual void setFrozen(std::string public_key) = 0;
+    virtual void setFrozen(int index) = 0;
+    virtual void thaw(std::string public_key) = 0;
+    virtual void thaw(int index) = 0;
+    virtual bool isTransferUnlocked(uint64_t unlockTime, uint64_t blockHeight) = 0;
+    virtual void setDescription(const std::string &public_key, const std::string &description) = 0;
+};
+
 struct SubaddressRow {
 public:
     SubaddressRow(std::size_t _rowId, const std::string &_address, const std::string &_label):
@@ -847,7 +892,8 @@ struct Wallet
                                                    optional<std::vector<uint64_t>> amount, uint32_t mixin_count,
                                                    PendingTransaction::Priority = PendingTransaction::Priority_Low,
                                                    uint32_t subaddr_account = 0,
-                                                   std::set<uint32_t> subaddr_indices = {}) = 0;
+                                                   std::set<uint32_t> subaddr_indices = {},
+                                                   const std::set<std::string> &preferred_inputs = {}) = 0;
 
     /*!
      * \brief createTransaction creates transaction. if dst_addr is an integrated address, payment_id is ignored
@@ -866,7 +912,8 @@ struct Wallet
                                                    optional<uint64_t> amount, uint32_t mixin_count,
                                                    PendingTransaction::Priority = PendingTransaction::Priority_Low,
                                                    uint32_t subaddr_account = 0,
-                                                   std::set<uint32_t> subaddr_indices = {}) = 0;
+                                                   std::set<uint32_t> subaddr_indices = {},
+                                                   const std::set<std::string> &preferred_inputs = {}) = 0;
 
     /*!
      * \brief createSweepUnmixableTransaction creates transaction with unmixable outputs.
@@ -942,6 +989,7 @@ struct Wallet
 
     virtual TransactionHistory * history() = 0;
     virtual AddressBook * addressBook() = 0;
+    virtual Coins * coins() = 0;
     virtual Subaddress * subaddress() = 0;
     virtual SubaddressAccount * subaddressAccount() = 0;
     virtual void setListener(WalletListener *) = 0;
diff --git a/src/wallet/wallet2.cpp b/src/wallet/wallet2.cpp
index c9881a735..c313b2c13 100644
--- a/src/wallet/wallet2.cpp
+++ b/src/wallet/wallet2.cpp
@@ -947,6 +947,16 @@ uint32_t get_subaddress_clamped_sum(uint32_t idx, uint32_t extra)
   return idx + extra;
 }
 
+bool is_preferred_input(const std::vector<crypto::key_image>& preferred_input_list, const crypto::key_image& input) {
+  if (!preferred_input_list.empty()) {
+    auto it = std::find(preferred_input_list.begin(), preferred_input_list.end(), input);
+    if (it == preferred_input_list.end()) {
+      return false;
+    }
+  }
+  return true;
+}
+
 static void setup_shim(hw::wallet_shim * shim, tools::wallet2 * wallet)
 {
   shim->get_tx_pub_key_from_received_outs = std::bind(&tools::wallet2::get_tx_pub_key_from_received_outs, wallet, std::placeholders::_1);
@@ -2063,12 +2073,21 @@ bool wallet2::frozen(const multisig_tx_set& txs) const
 
   return false;
 }
+void wallet2::freeze(const crypto::public_key &pk)
+{
+  freeze(get_transfer_details(pk));
+}
 //----------------------------------------------------------------------------------------------------
 void wallet2::freeze(const crypto::key_image &ki)
 {
   freeze(get_transfer_details(ki));
 }
 //----------------------------------------------------------------------------------------------------
+void wallet2::thaw(const crypto::public_key &pk)
+{
+    thaw(get_transfer_details(pk));
+}
+//----------------------------------------------------------------------------------------------------
 void wallet2::thaw(const crypto::key_image &ki)
 {
   thaw(get_transfer_details(ki));
@@ -2079,6 +2098,18 @@ bool wallet2::frozen(const crypto::key_image &ki) const
   return frozen(get_transfer_details(ki));
 }
 //----------------------------------------------------------------------------------------------------
+size_t wallet2::get_transfer_details(const crypto::public_key &pk) const
+{
+    for (size_t idx = 0; idx < m_transfers.size(); ++idx)
+    {
+        const transfer_details &td = m_transfers[idx];
+        if (td.get_public_key() == pk) {
+            return idx;
+        }
+    }
+    CHECK_AND_ASSERT_THROW_MES(false, "Public key not found");
+}
+//----------------------------------------------------------------------------------------------------
 size_t wallet2::get_transfer_details(const crypto::key_image &ki) const
 {
   for (size_t idx = 0; idx < m_transfers.size(); ++idx)
@@ -2474,6 +2505,7 @@ void wallet2::process_new_transaction(const crypto::hash &txid, const cryptonote
           uint64_t amount = tx.vout[o].amount ? tx.vout[o].amount : tx_scan_info[o].amount;
           if (!pool)
           {
+            boost::unique_lock<boost::shared_mutex> lock(m_transfers_mutex);
 	    m_transfers.push_back(transfer_details{});
 	    transfer_details& td = m_transfers.back();
 	    td.m_block_height = height;
@@ -2577,6 +2609,7 @@ void wallet2::process_new_transaction(const crypto::hash &txid, const cryptonote
           uint64_t extra_amount = amount - burnt;
           if (!pool)
           {
+            boost::unique_lock<boost::shared_mutex> lock(m_transfers_mutex);
             transfer_details &td = m_transfers[kit->second];
 	    td.m_block_height = height;
 	    td.m_internal_output_index = o;
@@ -10004,7 +10037,7 @@ void wallet2::transfer_selected_rct(std::vector<cryptonote::tx_destination_entry
   LOG_PRINT_L2("transfer_selected_rct done");
 }
 
-std::vector<size_t> wallet2::pick_preferred_rct_inputs(uint64_t needed_money, uint32_t subaddr_account, const std::set<uint32_t> &subaddr_indices)
+std::vector<size_t> wallet2::pick_preferred_rct_inputs(uint64_t needed_money, uint32_t subaddr_account, const std::set<uint32_t> &subaddr_indices, const std::vector<crypto::key_image>& preferred_input_list)
 {
   std::vector<size_t> picks;
   float current_output_relatdness = 1.0f;
@@ -10015,6 +10048,9 @@ std::vector<size_t> wallet2::pick_preferred_rct_inputs(uint64_t needed_money, ui
   for (size_t i = 0; i < m_transfers.size(); ++i)
   {
     const transfer_details& td = m_transfers[i];
+    if (!is_preferred_input(preferred_input_list, td.m_key_image)) {
+      continue;
+    }
     if (!is_spent(td, false) && !td.m_frozen && td.is_rct() && td.amount() >= needed_money && is_transfer_unlocked(td) && td.m_subaddr_index.major == subaddr_account && subaddr_indices.count(td.m_subaddr_index.minor) == 1)
     {
       if (td.amount() > m_ignore_outputs_above || td.amount() < m_ignore_outputs_below)
@@ -10035,6 +10071,9 @@ std::vector<size_t> wallet2::pick_preferred_rct_inputs(uint64_t needed_money, ui
   for (size_t i = 0; i < m_transfers.size(); ++i)
   {
     const transfer_details& td = m_transfers[i];
+    if (!is_preferred_input(preferred_input_list, td.m_key_image)) {
+      continue;
+    }
     if (!is_spent(td, false) && !td.m_frozen && !td.m_key_image_partial && td.is_rct() && is_transfer_unlocked(td) && td.m_subaddr_index.major == subaddr_account && subaddr_indices.count(td.m_subaddr_index.minor) == 1)
     {
       if (td.amount() > m_ignore_outputs_above || td.amount() < m_ignore_outputs_below)
@@ -10046,6 +10085,9 @@ std::vector<size_t> wallet2::pick_preferred_rct_inputs(uint64_t needed_money, ui
       for (size_t j = i + 1; j < m_transfers.size(); ++j)
       {
         const transfer_details& td2 = m_transfers[j];
+        if (!is_preferred_input(preferred_input_list, td2.m_key_image)) {
+          continue;
+        }
         if (td2.amount() > m_ignore_outputs_above || td2.amount() < m_ignore_outputs_below)
         {
           MDEBUG("Ignoring output " << j << " of amount " << print_money(td2.amount()) << " which is outside prescribed range [" << print_money(m_ignore_outputs_below) << ", " << print_money(m_ignore_outputs_above) << "]");
@@ -10618,7 +10660,7 @@ bool wallet2::light_wallet_key_image_is_ours(const crypto::key_image& key_image,
 // This system allows for sending (almost) the entire balance, since it does
 // not generate spurious change in all txes, thus decreasing the instantaneous
 // usable balance.
-std::vector<wallet2::pending_tx> wallet2::create_transactions_2(std::vector<cryptonote::tx_destination_entry> dsts, const size_t fake_outs_count, uint32_t priority, const std::vector<uint8_t>& extra, uint32_t subaddr_account, std::set<uint32_t> subaddr_indices, const unique_index_container& subtract_fee_from_outputs)
+std::vector<wallet2::pending_tx> wallet2::create_transactions_2(std::vector<cryptonote::tx_destination_entry> dsts, const size_t fake_outs_count, uint32_t priority, const std::vector<uint8_t>& extra, uint32_t subaddr_account, std::set<uint32_t> subaddr_indices, const std::vector<crypto::key_image>& preferred_input_list, const unique_index_container& subtract_fee_from_outputs)
 {
   //ensure device is let in NONE mode in any case
   hw::device &hwdev = m_account.get_device();
@@ -10826,6 +10868,9 @@ std::vector<wallet2::pending_tx> wallet2::create_transactions_2(std::vector<cryp
   for (size_t i = 0; i < m_transfers.size(); ++i)
   {
     const transfer_details& td = m_transfers[i];
+    if (!is_preferred_input(preferred_input_list, td.m_key_image)) {
+      continue;
+    }
     if (m_ignore_fractional_outputs && td.amount() < fractional_threshold)
     {
       MDEBUG("Ignoring output " << i << " of amount " << print_money(td.amount()) << " which is below fractional threshold " << print_money(fractional_threshold));
@@ -10911,7 +10956,7 @@ std::vector<wallet2::pending_tx> wallet2::create_transactions_2(std::vector<cryp
     // will get us a known fee.
     uint64_t estimated_fee = estimate_fee(use_per_byte_fee, use_rct, 2, fake_outs_count, 2, extra.size(), bulletproof, clsag, bulletproof_plus, use_view_tags, base_fee, fee_quantization_mask);
     total_needed_money = needed_money + (subtract_fee_from_outputs.size() ? 0 : estimated_fee);
-    preferred_inputs = pick_preferred_rct_inputs(total_needed_money, subaddr_account, subaddr_indices);
+    preferred_inputs = pick_preferred_rct_inputs(total_needed_money, subaddr_account, subaddr_indices, preferred_input_list);
     if (!preferred_inputs.empty())
     {
       string s;
@@ -11390,7 +11435,7 @@ bool wallet2::sanity_check(const std::vector<wallet2::pending_tx> &ptx_vector, c
   return true;
 }
 
-std::vector<wallet2::pending_tx> wallet2::create_transactions_all(uint64_t below, const cryptonote::account_public_address &address, bool is_subaddress, const size_t outputs, const size_t fake_outs_count, uint32_t priority, const std::vector<uint8_t>& extra, uint32_t subaddr_account, std::set<uint32_t> subaddr_indices)
+std::vector<wallet2::pending_tx> wallet2::create_transactions_all(uint64_t below, const cryptonote::account_public_address &address, bool is_subaddress, const size_t outputs, const size_t fake_outs_count, uint32_t priority, const std::vector<uint8_t>& extra, uint32_t subaddr_account, std::set<uint32_t> subaddr_indices, const std::vector<crypto::key_image>& preferred_input_list)
 {
   std::vector<size_t> unused_transfers_indices;
   std::vector<size_t> unused_dust_indices;
@@ -11419,6 +11464,9 @@ std::vector<wallet2::pending_tx> wallet2::create_transactions_all(uint64_t below
   for (size_t i = 0; i < m_transfers.size(); ++i)
   {
     const transfer_details& td = m_transfers[i];
+    if (!is_preferred_input(preferred_input_list, td.m_key_image)) {
+      continue;
+    }
     if (m_ignore_fractional_outputs && td.amount() < fractional_threshold)
     {
       MDEBUG("Ignoring output " << i << " of amount " << print_money(td.amount()) << " which is below threshold " << print_money(fractional_threshold));
diff --git a/src/wallet/wallet2.h b/src/wallet/wallet2.h
index 3ac99a990..ee5f7bfd9 100644
--- a/src/wallet/wallet2.h
+++ b/src/wallet/wallet2.h
@@ -1137,8 +1137,8 @@ private:
     bool parse_unsigned_tx_from_str(const std::string &unsigned_tx_st, unsigned_tx_set &exported_txs) const;
     bool load_tx(const std::string &signed_filename, std::vector<tools::wallet2::pending_tx> &ptx, std::function<bool(const signed_tx_set&)> accept_func = NULL);
     bool parse_tx_from_str(const std::string &signed_tx_st, std::vector<tools::wallet2::pending_tx> &ptx, std::function<bool(const signed_tx_set &)> accept_func);
-    std::vector<wallet2::pending_tx> create_transactions_2(std::vector<cryptonote::tx_destination_entry> dsts, const size_t fake_outs_count, uint32_t priority, const std::vector<uint8_t>& extra, uint32_t subaddr_account, std::set<uint32_t> subaddr_indices, const unique_index_container& subtract_fee_from_outputs = {});     // pass subaddr_indices by value on purpose
-    std::vector<wallet2::pending_tx> create_transactions_all(uint64_t below, const cryptonote::account_public_address &address, bool is_subaddress, const size_t outputs, const size_t fake_outs_count, uint32_t priority, const std::vector<uint8_t>& extra, uint32_t subaddr_account, std::set<uint32_t> subaddr_indices);
+    std::vector<wallet2::pending_tx> create_transactions_2(std::vector<cryptonote::tx_destination_entry> dsts, const size_t fake_outs_count, uint32_t priority, const std::vector<uint8_t>& extra, uint32_t subaddr_account, std::set<uint32_t> subaddr_indices, const std::vector<crypto::key_image>& preferred_input_list = {}, const unique_index_container& subtract_fee_from_outputs = {});     // pass subaddr_indices by value on purpose
+    std::vector<wallet2::pending_tx> create_transactions_all(uint64_t below, const cryptonote::account_public_address &address, bool is_subaddress, const size_t outputs, const size_t fake_outs_count, uint32_t priority, const std::vector<uint8_t>& extra, uint32_t subaddr_account, std::set<uint32_t> subaddr_indices, const std::vector<crypto::key_image>& preferred_input_list = {});
     std::vector<wallet2::pending_tx> create_transactions_single(const crypto::key_image &ki, const cryptonote::account_public_address &address, bool is_subaddress, const size_t outputs, const size_t fake_outs_count, uint32_t priority, const std::vector<uint8_t>& extra);
     std::vector<wallet2::pending_tx> create_transactions_from(const cryptonote::account_public_address &address, bool is_subaddress, const size_t outputs, std::vector<size_t> unused_transfers_indices, std::vector<size_t> unused_dust_indices, const size_t fake_outs_count, uint32_t priority, const std::vector<uint8_t>& extra);
     bool sanity_check(const std::vector<wallet2::pending_tx> &ptx_vector, const std::vector<cryptonote::tx_destination_entry>& dsts, const unique_index_container& subtract_fee_from_outputs = {}) const;
@@ -1473,6 +1473,7 @@ private:
     uint64_t get_num_rct_outputs();
     size_t get_num_transfer_details() const { return m_transfers.size(); }
     const transfer_details &get_transfer_details(size_t idx) const;
+    size_t get_transfer_details(const crypto::public_key &pk) const;
 
     uint8_t get_current_hard_fork();
     void get_hard_fork_info(uint8_t version, uint64_t &earliest_height);
@@ -1702,7 +1703,9 @@ private:
     void freeze(size_t idx);
     void thaw(size_t idx);
     bool frozen(size_t idx) const;
+    void freeze(const crypto::public_key &pk);
     void freeze(const crypto::key_image &ki);
+    void thaw(const crypto::public_key &pk);
     void thaw(const crypto::key_image &ki);
     bool frozen(const crypto::key_image &ki) const;
     bool frozen(const transfer_details &td) const;
@@ -1740,6 +1743,8 @@ private:
 
     static std::string get_default_daemon_address() { CRITICAL_REGION_LOCAL(default_daemon_address_lock); return default_daemon_address; }
 
+      boost::shared_mutex m_transfers_mutex;
+
   private:
     /*!
      * \brief  Stores wallet information to wallet file.
@@ -1798,7 +1803,7 @@ private:
     std::vector<uint64_t> get_unspent_amounts_vector(bool strict);
     uint64_t get_dynamic_base_fee_estimate();
     float get_output_relatedness(const transfer_details &td0, const transfer_details &td1) const;
-    std::vector<size_t> pick_preferred_rct_inputs(uint64_t needed_money, uint32_t subaddr_account, const std::set<uint32_t> &subaddr_indices);
+    std::vector<size_t> pick_preferred_rct_inputs(uint64_t needed_money, uint32_t subaddr_account, const std::set<uint32_t> &subaddr_indices, const std::vector<crypto::key_image>& preferred_input_list);
     void set_spent(size_t idx, uint64_t height);
     void set_unspent(size_t idx);
     bool is_spent(const transfer_details &td, bool strict = true) const;
diff --git a/src/wallet/wallet_rpc_server.cpp b/src/wallet/wallet_rpc_server.cpp
index b1419949f..4b33d51c3 100644
--- a/src/wallet/wallet_rpc_server.cpp
+++ b/src/wallet/wallet_rpc_server.cpp
@@ -1099,7 +1099,7 @@ namespace tools
     {
       uint64_t mixin = m_wallet->adjust_mixin(req.ring_size ? req.ring_size - 1 : 0);
       uint32_t priority = m_wallet->adjust_priority(req.priority);
-      std::vector<wallet2::pending_tx> ptx_vector = m_wallet->create_transactions_2(dsts, mixin, priority, extra, req.account_index, req.subaddr_indices, req.subtract_fee_from_outputs);
+      std::vector<wallet2::pending_tx> ptx_vector = m_wallet->create_transactions_2(dsts, mixin, priority, extra, req.account_index, req.subaddr_indices, {}, req.subtract_fee_from_outputs);
 
       if (ptx_vector.empty())
       {